C13H16F7NO4 — CID 170638932
2-[2,2,3,3,4,4,4-heptafluorobutyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate (PubChem CID 170638932) has the molecular formula C13H16F7NO4 and a molecular weight of 383.26 g/mol. Its IUPAC name is 2-[2,2,3,3,4,4,4-heptafluorobutyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate.
| Compound Name | 2-[2,2,3,3,4,4,4-heptafluorobutyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate |
|---|---|
| PubChem CID | 170638932 |
| Molecular Formula | C13H16F7NO4 |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-[2,2,3,3,4,4,4-heptafluorobutyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]acetate |
| SMILES | C=C(C)C(=O)OCC[N+](C)(CC(=O)[O-])CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H16F7NO4/c1-8(2)10(24)25-5-4-21(3,6-9(22)23)7-11(14,15)12(16,17)13(18,19)20/h1,4-7H2,2-3H3 |
| InChIKey | JXOFOQWXBYCOFY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|