C11H17F3NO4+ — CID 170638923
(1-carboxy-2,2,2-trifluoroethyl)-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium (PubChem CID 170638923) has the molecular formula C11H17F3NO4+ and a molecular weight of 284.25 g/mol. Its IUPAC name is (1-carboxy-2,2,2-trifluoroethyl)-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium.
| Compound Name | (1-carboxy-2,2,2-trifluoroethyl)-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 170638923 |
| Molecular Formula | C11H17F3NO4+ |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (1-carboxy-2,2,2-trifluoroethyl)-dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)C(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3NO4/c1-7(2)10(18)19-6-5-15(3,4)8(9(16)17)11(12,13)14/h8H,1,5-6H2,2-4H3/p+1 |
| InChIKey | XIDPNUPVYFSUQT-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|