C38H57NO22S — CID 157276637
methyl sulfate;methyl-tris[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobutanoyl]oxyethyl]azanium (PubChem CID 157276637) has the molecular formula C38H57NO22S and a molecular weight of 911.93 g/mol. Its IUPAC name is methyl sulfate;methyl-tris[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobutanoyl]oxyethyl]azanium.
| Compound Name | methyl sulfate;methyl-tris[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobutanoyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 157276637 |
| Molecular Formula | C38H57NO22S |
| Molecular Weight | 911.93 g/mol |
| Exact Mass | 911.31 |
| IUPAC Name | methyl sulfate;methyl-tris[2-[4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobutanoyl]oxyethyl]azanium |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)OCC[N+](C)(CCOC(=O)CCC(=O)OCCOC(=O)C(=C)C)CCOC(=O)CCC(=O)OCCOC(=O)C(=C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C37H54NO18.CH4O4S/c1-26(2)35(45)54-23-20-51-32(42)11-8-29(39)48-17-14-38(7,15-18-49-30(40)9-12-33(43)52-21-24-55-36(46)27(3)4)16-19-50-31(41)10-13-34(44)53-22-25-56-37(47)28(5)6;1-5-6(2,3)4/h1,3,5,8-25H2,2,4,6-7H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | QZANWENNBVKTQD-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 303.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.93 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|