C32H60NO5+ — CID 154986768
methyl-[2-(2-methylprop-2-enoyloxy)ethyl]-[2-(4,4,6,6-tetramethylhept-1-en-2-yloxy)ethyl]-[2-(3,3,5,5-tetramethylhexanoyloxy)ethyl]azanium (PubChem CID 154986768) has the molecular formula C32H60NO5+ and a molecular weight of 538.83 g/mol. Its IUPAC name is methyl-[2-(2-methylprop-2-enoyloxy)ethyl]-[2-(4,4,6,6-tetramethylhept-1-en-2-yloxy)ethyl]-[2-(3,3,5,5-tetramethylhexanoyloxy)ethyl]azanium.
| Compound Name | methyl-[2-(2-methylprop-2-enoyloxy)ethyl]-[2-(4,4,6,6-tetramethylhept-1-en-2-yloxy)ethyl]-[2-(3,3,5,5-tetramethylhexanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 154986768 |
| Molecular Formula | C32H60NO5+ |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 538.45 |
| IUPAC Name | methyl-[2-(2-methylprop-2-enoyloxy)ethyl]-[2-(4,4,6,6-tetramethylhept-1-en-2-yloxy)ethyl]-[2-(3,3,5,5-tetramethylhexanoyloxy)ethyl]azanium |
| SMILES | C=C(CC(C)(C)CC(C)(C)C)OCC[N+](C)(CCOC(=O)CC(C)(C)CC(C)(C)C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C32H60NO5/c1-25(2)28(35)38-20-17-33(14,15-18-36-26(3)21-31(10,11)23-29(4,5)6)16-19-37-27(34)22-32(12,13)24-30(7,8)9/h1,3,15-24H2,2,4-14H3/q+1 |
| InChIKey | FAUUXFUFEXOQQH-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|