C23H46BrNO2 — CID 134305002
hexadecyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium bromide (PubChem CID 134305002) has the molecular formula C23H46BrNO2 and a molecular weight of 448.53 g/mol. Its IUPAC name is hexadecyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium bromide.
| Compound Name | hexadecyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium bromide |
|---|---|
| PubChem CID | 134305002 |
| Molecular Formula | C23H46BrNO2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | hexadecyl-methyl-[2-(2-methylprop-2-enoyloxy)ethyl]azanium bromide |
| SMILES | C=C(C)C(=O)OCC[NH+](C)CCCCCCCCCCCCCCCC.[Br-] |
| InChI | InChI=1S/C23H45NO2.BrH/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(4)20-21-26-23(25)22(2)3;/h2,5-21H2,1,3-4H3;1H |
| InChIKey | GKDSLLIBBRULEB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|