C13H28N2O5S — CID 174689164
dimethyl-[1-(2-methylprop-2-enoylamino)ethyl]-propylazanium;ethyl sulfate (PubChem CID 174689164) has the molecular formula C13H28N2O5S and a molecular weight of 324.44 g/mol. Its IUPAC name is dimethyl-[1-(2-methylprop-2-enoylamino)ethyl]-propylazanium;ethyl sulfate.
| Compound Name | dimethyl-[1-(2-methylprop-2-enoylamino)ethyl]-propylazanium;ethyl sulfate |
|---|---|
| PubChem CID | 174689164 |
| Molecular Formula | C13H28N2O5S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | dimethyl-[1-(2-methylprop-2-enoylamino)ethyl]-propylazanium;ethyl sulfate |
| SMILES | C=C(C)C(=O)NC(C)[N+](C)(C)CCC.CCOS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H22N2O.C2H6O4S/c1-7-8-13(5,6)10(4)12-11(14)9(2)3;1-2-6-7(3,4)5/h10H,2,7-8H2,1,3-6H3;2H2,1H3,(H,3,4,5) |
| InChIKey | SBSSECZZDGPUTJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 95.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|