C18H14ClNO4S — CID 102569369
2-(4-chlorophenyl)sulfonyl-1-formyl-3-(4-methoxyphenyl)cyclopropane-1-carbonitrile (PubChem CID 102569369) has the molecular formula C18H14ClNO4S and a molecular weight of 375.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-formyl-3-(4-methoxyphenyl)cyclopropane-1-carbonitrile.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-formyl-3-(4-methoxyphenyl)cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 102569369 |
| Molecular Formula | C18H14ClNO4S |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-formyl-3-(4-methoxyphenyl)cyclopropane-1-carbonitrile |
| SMILES | COc1ccc(C2C(S(=O)(=O)c3ccc(Cl)cc3)C2(C#N)C=O)cc1 |
| InChI | InChI=1S/C18H14ClNO4S/c1-24-14-6-2-12(3-7-14)16-17(18(16,10-20)11-21)25(22,23)15-8-4-13(19)5-9-15/h2-9,11,16-17H,1H3 |
| InChIKey | AICLLSNWTNQVTL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|