C15H22O4S — CID 101107088
(2R,3S)-4,4-diethyl-2-(4-methylphenyl)sulfonyloxolan-3-ol (PubChem CID 101107088) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is (2R,3S)-4,4-diethyl-2-(4-methylphenyl)sulfonyloxolan-3-ol.
| Compound Name | (2R,3S)-4,4-diethyl-2-(4-methylphenyl)sulfonyloxolan-3-ol |
|---|---|
| PubChem CID | 101107088 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2R,3S)-4,4-diethyl-2-(4-methylphenyl)sulfonyloxolan-3-ol |
| SMILES | CCC1(CC)CO[C@H](S(=O)(=O)c2ccc(C)cc2)[C@H]1O |
| InChI | InChI=1S/C15H22O4S/c1-4-15(5-2)10-19-14(13(15)16)20(17,18)12-8-6-11(3)7-9-12/h6-9,13-14,16H,4-5,10H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | UGUYMUMTVQXLKP-ZIAGYGMSSA-N |
| XLogP | 2.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |