C11H11BrO2S — CID 102324021
[(1E)-2-bromo-3-methylbuta-1,3-dienyl]sulfonylbenzene (PubChem CID 102324021) has the molecular formula C11H11BrO2S and a molecular weight of 287.18 g/mol. Its IUPAC name is [(1E)-2-bromo-3-methylbuta-1,3-dienyl]sulfonylbenzene.
| Compound Name | [(1E)-2-bromo-3-methylbuta-1,3-dienyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102324021 |
| Molecular Formula | C11H11BrO2S |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.97 |
| IUPAC Name | [(1E)-2-bromo-3-methylbuta-1,3-dienyl]sulfonylbenzene |
| SMILES | C=C(C)/C(Br)=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H11BrO2S/c1-9(2)11(12)8-15(13,14)10-6-4-3-5-7-10/h3-8H,1H2,2H3/b11-8+ |
| InChIKey | XWLDEKXWADJZSD-DHZHZOJOSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|