C14H19BrO3S — CID 102324017
(E)-1-(benzenesulfonyl)-2-bromooct-1-en-3-ol (PubChem CID 102324017) has the molecular formula C14H19BrO3S and a molecular weight of 347.27 g/mol. Its IUPAC name is (E)-1-(benzenesulfonyl)-2-bromooct-1-en-3-ol.
| Compound Name | (E)-1-(benzenesulfonyl)-2-bromooct-1-en-3-ol |
|---|---|
| PubChem CID | 102324017 |
| Molecular Formula | C14H19BrO3S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | (E)-1-(benzenesulfonyl)-2-bromooct-1-en-3-ol |
| SMILES | CCCCCC(O)/C(Br)=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19BrO3S/c1-2-3-5-10-14(16)13(15)11-19(17,18)12-8-6-4-7-9-12/h4,6-9,11,14,16H,2-3,5,10H2,1H3/b13-11+ |
| InChIKey | JPDFXQQGFBTDQR-ACCUITESSA-N |
| XLogP | 3.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|