C13H15NO3S — CID 114618691
(E)-3-(benzenesulfonyl)-N-(2-methylprop-2-enyl)prop-2-enamide (PubChem CID 114618691) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-(2-methylprop-2-enyl)prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-(2-methylprop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 114618691 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-(2-methylprop-2-enyl)prop-2-enamide |
| SMILES | C=C(C)CNC(=O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO3S/c1-11(2)10-14-13(15)8-9-18(16,17)12-6-4-3-5-7-12/h3-9H,1,10H2,2H3,(H,14,15)/b9-8+ |
| InChIKey | SRMJZQXXTLKSMR-CMDGGOBGSA-N |
| XLogP | 1.67 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|