C14H19NO4S2 — CID 106156575
(E)-3-(benzenesulfonyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide (PubChem CID 106156575) has the molecular formula C14H19NO4S2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 106156575 |
| Molecular Formula | C14H19NO4S2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)prop-2-enamide |
| SMILES | CSC(CO)C(C)NC(=O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO4S2/c1-11(13(10-16)20-2)15-14(17)8-9-21(18,19)12-6-4-3-5-7-12/h3-9,11,13,16H,10H2,1-2H3,(H,15,17)/b9-8+ |
| InChIKey | UDFMJSBRPMZSBB-CMDGGOBGSA-N |
| XLogP | 1.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|