C14H19NO4S — CID 106120590
(E)-3-(benzenesulfonyl)-N-(4-hydroxypentyl)prop-2-enamide (PubChem CID 106120590) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-(4-hydroxypentyl)prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-(4-hydroxypentyl)prop-2-enamide |
|---|---|
| PubChem CID | 106120590 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-(4-hydroxypentyl)prop-2-enamide |
| SMILES | CC(O)CCCNC(=O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H19NO4S/c1-12(16)6-5-10-15-14(17)9-11-20(18,19)13-7-3-2-4-8-13/h2-4,7-9,11-12,16H,5-6,10H2,1H3,(H,15,17)/b11-9+ |
| InChIKey | ASTCNAZNABELRK-PKNBQFBNSA-N |
| XLogP | 1.25 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|