C14H14N2O3S — CID 106385183
(E)-3-(benzenesulfonyl)-N-(1H-pyrrol-3-ylmethyl)prop-2-enamide (PubChem CID 106385183) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (E)-3-(benzenesulfonyl)-N-(1H-pyrrol-3-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(benzenesulfonyl)-N-(1H-pyrrol-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 106385183 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (E)-3-(benzenesulfonyl)-N-(1H-pyrrol-3-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/S(=O)(=O)c1ccccc1)NCc1cc[nH]c1 |
| InChI | InChI=1S/C14H14N2O3S/c17-14(16-11-12-6-8-15-10-12)7-9-20(18,19)13-4-2-1-3-5-13/h1-10,15H,11H2,(H,16,17)/b9-7+ |
| InChIKey | IIDXXGJENAYDJS-VQHVLOKHSA-N |
| XLogP | 1.62 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|