C12H13NO5S — CID 43623308
methyl 2-[[(E)-3-(benzenesulfonyl)prop-2-enoyl]amino]acetate (PubChem CID 43623308) has the molecular formula C12H13NO5S and a molecular weight of 283.31 g/mol. Its IUPAC name is methyl 2-[[(E)-3-(benzenesulfonyl)prop-2-enoyl]amino]acetate.
| Compound Name | methyl 2-[[(E)-3-(benzenesulfonyl)prop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 43623308 |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | methyl 2-[[(E)-3-(benzenesulfonyl)prop-2-enoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO5S/c1-18-12(15)9-13-11(14)7-8-19(16,17)10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,13,14)/b8-7+ |
| InChIKey | ZHXDWYIREMDEHA-BQYQJAHWSA-N |
| XLogP | 0.26 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|