C10H19NO2S — CID 103798990
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methylbut-2-enamide (PubChem CID 103798990) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methylbut-2-enamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 103798990 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-3-methylbut-2-enamide |
| SMILES | CSC(CO)C(C)NC(=O)C=C(C)C |
| InChI | InChI=1S/C10H19NO2S/c1-7(2)5-10(13)11-8(3)9(6-12)14-4/h5,8-9,12H,6H2,1-4H3,(H,11,13) |
| InChIKey | ROFBVQRSHVVEON-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|