C10H22N2O2S — CID 106161614
N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methyl-2-(methylamino)propanamide (PubChem CID 106161614) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methyl-2-(methylamino)propanamide.
| Compound Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 106161614 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methyl-2-(methylamino)propanamide |
| SMILES | CNC(C)(C)C(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C10H22N2O2S/c1-7(8(6-13)15-5)12-9(14)10(2,3)11-4/h7-8,11,13H,6H2,1-5H3,(H,12,14) |
| InChIKey | QOADXSIKDXWHAL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |