C13H25NO4S — CID 114151192
4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid (PubChem CID 114151192) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid.
| Compound Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 114151192 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-methyl-4-oxo-2-propan-2-ylbutanoic acid |
| SMILES | CSC(CO)C(C)NC(=O)CC(C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H25NO4S/c1-8(2)13(4,12(17)18)6-11(16)14-9(3)10(7-15)19-5/h8-10,15H,6-7H2,1-5H3,(H,14,16)(H,17,18) |
| InChIKey | GLSURCVBZYEKQF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |