C9H20N2O3S — CID 106161500
3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methoxypropanamide (PubChem CID 106161500) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methoxypropanamide.
| Compound Name | 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methoxypropanamide |
|---|---|
| PubChem CID | 106161500 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-amino-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-2-methoxypropanamide |
| SMILES | COC(CN)C(=O)NC(C)C(CO)SC |
| InChI | InChI=1S/C9H20N2O3S/c1-6(8(5-12)15-3)11-9(13)7(4-10)14-2/h6-8,12H,4-5,10H2,1-3H3,(H,11,13) |
| InChIKey | GMMKNHVVUFIDAU-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |