C13H28N2O2S — CID 114152047
3-(aminomethyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5-methylhexanamide (PubChem CID 114152047) has the molecular formula C13H28N2O2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5-methylhexanamide.
| Compound Name | 3-(aminomethyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5-methylhexanamide |
|---|---|
| PubChem CID | 114152047 |
| Molecular Formula | C13H28N2O2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.19 |
| IUPAC Name | 3-(aminomethyl)-N-(4-hydroxy-3-methylsulfanylbutan-2-yl)-5-methylhexanamide |
| SMILES | CSC(CO)C(C)NC(=O)CC(CN)CC(C)C |
| InChI | InChI=1S/C13H28N2O2S/c1-9(2)5-11(7-14)6-13(17)15-10(3)12(8-16)18-4/h9-12,16H,5-8,14H2,1-4H3,(H,15,17) |
| InChIKey | CAMGPHUCSYXORL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |