C13H23NO2S — CID 97247758
2-cyclopentylidene-N-[(2R,3S)-4-hydroxy-3-methylsulfanylbutan-2-yl]propanamide (PubChem CID 97247758) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-cyclopentylidene-N-[(2R,3S)-4-hydroxy-3-methylsulfanylbutan-2-yl]propanamide.
| Compound Name | 2-cyclopentylidene-N-[(2R,3S)-4-hydroxy-3-methylsulfanylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 97247758 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-cyclopentylidene-N-[(2R,3S)-4-hydroxy-3-methylsulfanylbutan-2-yl]propanamide |
| SMILES | CS[C@H](CO)[C@@H](C)NC(=O)C(C)=C1CCCC1 |
| InChI | InChI=1S/C13H23NO2S/c1-9(11-6-4-5-7-11)13(16)14-10(2)12(8-15)17-3/h10,12,15H,4-8H2,1-3H3,(H,14,16)/t10-,12-/m1/s1 |
| InChIKey | KMSUBCQANWITIR-ZYHUDNBSSA-N |
| XLogP | 2.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|