C15H23N3O3S — CID 167809937
N-[3-(aminomethyl)-5-methylphenyl]-N'-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxamide (PubChem CID 167809937) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N-[3-(aminomethyl)-5-methylphenyl]-N'-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxamide.
| Compound Name | N-[3-(aminomethyl)-5-methylphenyl]-N'-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxamide |
|---|---|
| PubChem CID | 167809937 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N-[3-(aminomethyl)-5-methylphenyl]-N'-(4-hydroxy-3-methylsulfanylbutan-2-yl)oxamide |
| SMILES | CSC(CO)C(C)NC(=O)C(=O)Nc1cc(C)cc(CN)c1 |
| InChI | InChI=1S/C15H23N3O3S/c1-9-4-11(7-16)6-12(5-9)18-15(21)14(20)17-10(2)13(8-19)22-3/h4-6,10,13,19H,7-8,16H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | QUAQHTCEWNBQKK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|