C12H13ClO2S — CID 134922038
(1-chloro-3-methylpenta-1,2-dienyl)sulfonylbenzene (PubChem CID 134922038) has the molecular formula C12H13ClO2S and a molecular weight of 256.75 g/mol. Its IUPAC name is (1-chloro-3-methylpenta-1,2-dienyl)sulfonylbenzene.
| Compound Name | (1-chloro-3-methylpenta-1,2-dienyl)sulfonylbenzene |
|---|---|
| PubChem CID | 134922038 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | (1-chloro-3-methylpenta-1,2-dienyl)sulfonylbenzene |
| SMILES | CCC(C)=C=C(Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13ClO2S/c1-3-10(2)9-12(13)16(14,15)11-7-5-4-6-8-11/h4-8H,3H2,1-2H3 |
| InChIKey | FXUVCPTUWZLOOL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |