C16H16O2S — CID 132577543
1-[1-(benzenesulfonyl)ethenyl]-3,5-dimethylbenzene (PubChem CID 132577543) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-[1-(benzenesulfonyl)ethenyl]-3,5-dimethylbenzene.
| Compound Name | 1-[1-(benzenesulfonyl)ethenyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 132577543 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 1-[1-(benzenesulfonyl)ethenyl]-3,5-dimethylbenzene |
| SMILES | C=C(c1cc(C)cc(C)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16O2S/c1-12-9-13(2)11-15(10-12)14(3)19(17,18)16-7-5-4-6-8-16/h4-11H,3H2,1-2H3 |
| InChIKey | VNIXJDDSJUDZKF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |