C23H23NO3S — CID 55916827
4-(benzenesulfonylmethyl)-N-(3,5-dimethylphenyl)-N-methylbenzamide (PubChem CID 55916827) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-N-(3,5-dimethylphenyl)-N-methylbenzamide.
| Compound Name | 4-(benzenesulfonylmethyl)-N-(3,5-dimethylphenyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 55916827 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-N-(3,5-dimethylphenyl)-N-methylbenzamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)c2ccc(CS(=O)(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H23NO3S/c1-17-13-18(2)15-21(14-17)24(3)23(25)20-11-9-19(10-12-20)16-28(26,27)22-7-5-4-6-8-22/h4-15H,16H2,1-3H3 |
| InChIKey | PANPSMIWEBNJLB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |