C10H11F — CID 130699738
1-(1-fluoroethenyl)-3,5-dimethylbenzene (PubChem CID 130699738) has the molecular formula C10H11F and a molecular weight of 150.20 g/mol. Its IUPAC name is 1-(1-fluoroethenyl)-3,5-dimethylbenzene.
| Compound Name | 1-(1-fluoroethenyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 130699738 |
| Molecular Formula | C10H11F |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-(1-fluoroethenyl)-3,5-dimethylbenzene |
| SMILES | C=C(F)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C10H11F/c1-7-4-8(2)6-10(5-7)9(3)11/h4-6H,3H2,1-2H3 |
| InChIKey | XKMWPOKPPORBSA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |