1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen

C11H16 — CID 163256290

IUPAC1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen
SMILESC=C(C)c1cc(C)cc(C)c1.[H][H]
InChIInChI=1S/C11H14.H2/c1-8(2)11-6-9(3)5-10(4)7-11;/h5-7H,1H2,2-4H3;1H
InChIKeyMCWKSAKOHWDZOG-UHFFFAOYSA-N
MW148.25 g/mol
LogP3.58
Rot. Bonds1

About 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen

1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen (PubChem CID 163256290) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen.

Molecular Properties

Compound Name1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen
PubChem CID163256290
Molecular FormulaC11H16
Molecular Weight148.25 g/mol
Exact Mass148.13
IUPAC Name1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen
SMILESC=C(C)c1cc(C)cc(C)c1.[H][H]
InChIInChI=1S/C11H14.H2/c1-8(2)11-6-9(3)5-10(4)7-11;/h5-7H,1H2,2-4H3;1H
InChIKeyMCWKSAKOHWDZOG-UHFFFAOYSA-N
XLogP3.58
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.25
LogP ≤ 53.58
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen?
The IUPAC name of 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen (CID 163256290) is 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen.
What is the SMILES notation for 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen?
The canonical SMILES for 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen is C=C(C)c1cc(C)cc(C)c1.[H][H].
What is the InChIKey of 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen?
The InChIKey is MCWKSAKOHWDZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.H2/c1-8(2)11-6-9(3)5-10(4)7-11;/h5-7H,1H2,2-4H3;1H.
What are the key properties of 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen?
1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen has a molecular weight of 148.25 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-5-prop-1-en-2-ylbenzene;molecular hydrogen is sourced from PubChem (CID 163256290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).