C12H14O3S — CID 14043494
3-[1-(benzenesulfonyl)ethenyl]-2,2-dimethyloxirane (PubChem CID 14043494) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)ethenyl]-2,2-dimethyloxirane.
| Compound Name | 3-[1-(benzenesulfonyl)ethenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 14043494 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 3-[1-(benzenesulfonyl)ethenyl]-2,2-dimethyloxirane |
| SMILES | C=C(C1OC1(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14O3S/c1-9(11-12(2,3)15-11)16(13,14)10-7-5-4-6-8-10/h4-8,11H,1H2,2-3H3 |
| InChIKey | BDEVXVDKSVOJGL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|