C16H21NO3S — CID 15305261
(3S,3aS,7aR)-3-[1-(benzenesulfonyl)ethenyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole (PubChem CID 15305261) has the molecular formula C16H21NO3S and a molecular weight of 307.41 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-[1-(benzenesulfonyl)ethenyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole.
| Compound Name | (3S,3aS,7aR)-3-[1-(benzenesulfonyl)ethenyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
|---|---|
| PubChem CID | 15305261 |
| Molecular Formula | C16H21NO3S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (3S,3aS,7aR)-3-[1-(benzenesulfonyl)ethenyl]-1-methyl-3a,4,5,6,7,7a-hexahydro-3H-2,1-benzoxazole |
| SMILES | C=C([C@H]1ON(C)[C@@H]2CCCC[C@H]12)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3S/c1-12(21(18,19)13-8-4-3-5-9-13)16-14-10-6-7-11-15(14)17(2)20-16/h3-5,8-9,14-16H,1,6-7,10-11H2,2H3/t14-,15+,16+/m0/s1 |
| InChIKey | TWXNSYGRCCCXTN-ARFHVFGLSA-N |
| XLogP | 2.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |