About 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene
1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene (PubChem CID 122210448) has the molecular formula C27H19FO2S
and a molecular weight of 426.51 g/mol. Its IUPAC name is 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene.
Molecular Properties
| Compound Name | 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene |
| PubChem CID | 122210448 |
| Molecular Formula | C27H19FO2S |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene |
| SMILES | O=S(=O)(C(=C=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H19FO2S/c28-24-16-18-25(19-17-24)31(29,30)27(23-14-8-3-9-15-23)20-26(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19H |
| InChIKey | GVEMWNOMZFIDQF-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene?
The IUPAC name of 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene (CID 122210448) is 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene.
What is the SMILES notation for 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene?
The canonical SMILES for 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene is O=S(=O)(C(=C=C(c1ccccc1)c1ccccc1)c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene?
The InChIKey is GVEMWNOMZFIDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H19FO2S/c28-24-16-18-25(19-17-24)31(29,30)27(23-14-8-3-9-15-23)20-26(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19H.
What are the key properties of 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene?
1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene has a molecular weight of 426.51 g/mol, XLogP of 6.37, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(1,3,3-triphenylpropa-1,2-dienylsulfonyl)benzene is sourced from PubChem (CID 122210448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).