C19H32N2O2S — CID 75168284
N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)hexanimidamide (PubChem CID 75168284) has the molecular formula C19H32N2O2S and a molecular weight of 352.54 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)hexanimidamide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)hexanimidamide |
|---|---|
| PubChem CID | 75168284 |
| Molecular Formula | C19H32N2O2S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)hexanimidamide |
| SMILES | CCCCCC(=NS(=O)(=O)c1ccc(C)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H32N2O2S/c1-7-8-9-10-19(21(15(2)3)16(4)5)20-24(22,23)18-13-11-17(6)12-14-18/h11-16H,7-10H2,1-6H3 |
| InChIKey | HLRHRKJGUBHRFJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|