C26H32N2O3S — CID 177420314
2-(6-methoxynaphthalen-2-yl)-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide (PubChem CID 177420314) has the molecular formula C26H32N2O3S and a molecular weight of 452.62 g/mol. Its IUPAC name is 2-(6-methoxynaphthalen-2-yl)-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide.
| Compound Name | 2-(6-methoxynaphthalen-2-yl)-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 177420314 |
| Molecular Formula | C26H32N2O3S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-(6-methoxynaphthalen-2-yl)-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide |
| SMILES | COc1ccc2cc(C/C(=N/S(=O)(=O)c3ccc(C)cc3)N(C(C)C)C(C)C)ccc2c1 |
| InChI | InChI=1S/C26H32N2O3S/c1-18(2)28(19(3)4)26(27-32(29,30)25-13-7-20(5)8-14-25)16-21-9-10-23-17-24(31-6)12-11-22(23)15-21/h7-15,17-19H,16H2,1-6H3/b27-26- |
| InChIKey | FPUGZKCNQZEKCD-RQZHXJHFSA-N |
| XLogP | 5.61 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|