C18H29ClN2O2S — CID 46225390
5-chloro-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)pentanimidamide (PubChem CID 46225390) has the molecular formula C18H29ClN2O2S and a molecular weight of 372.96 g/mol. Its IUPAC name is 5-chloro-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)pentanimidamide.
| Compound Name | 5-chloro-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)pentanimidamide |
|---|---|
| PubChem CID | 46225390 |
| Molecular Formula | C18H29ClN2O2S |
| Molecular Weight | 372.96 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5-chloro-N'-(4-methylphenyl)sulfonyl-N,N-di(propan-2-yl)pentanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/CCCCCl)N(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C18H29ClN2O2S/c1-14(2)21(15(3)4)18(8-6-7-13-19)20-24(22,23)17-11-9-16(5)10-12-17/h9-12,14-15H,6-8,13H2,1-5H3/b20-18- |
| InChIKey | WGSSXDZOVDPUPT-ZZEZOPTASA-N |
| XLogP | 4.61 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.96 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|