C17H27ClN2O2S — CID 177430117
N'-(4-chlorophenyl)sulfonyl-N,N-diethylheptanimidamide (PubChem CID 177430117) has the molecular formula C17H27ClN2O2S and a molecular weight of 358.94 g/mol. Its IUPAC name is N'-(4-chlorophenyl)sulfonyl-N,N-diethylheptanimidamide.
| Compound Name | N'-(4-chlorophenyl)sulfonyl-N,N-diethylheptanimidamide |
|---|---|
| PubChem CID | 177430117 |
| Molecular Formula | C17H27ClN2O2S |
| Molecular Weight | 358.94 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-(4-chlorophenyl)sulfonyl-N,N-diethylheptanimidamide |
| SMILES | CCCCCC/C(=N\S(=O)(=O)c1ccc(Cl)cc1)N(CC)CC |
| InChI | InChI=1S/C17H27ClN2O2S/c1-4-7-8-9-10-17(20(5-2)6-3)19-23(21,22)16-13-11-15(18)12-14-16/h11-14H,4-10H2,1-3H3/b19-17+ |
| InChIKey | GWMNGNKQGUAYPE-HTXNQAPBSA-N |
| XLogP | 4.74 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.94 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|