About benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane
benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane (PubChem CID 91521840) has the molecular formula C34H50O3S
and a molecular weight of 538.84 g/mol. Its IUPAC name is benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane.
Molecular Properties
| Compound Name | benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane |
| PubChem CID | 91521840 |
| Molecular Formula | C34H50O3S |
| Molecular Weight | 538.84 g/mol |
| Exact Mass | 538.35 |
| IUPAC Name | benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane |
| SMILES | CCCCCCCCCCCCC.Cc1ccc(Cc2ccc(C)cc2)cc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C15H16.C13H28.C6H6O3S/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-3-5-7-9-11-13-12-10-8-6-4-2;7-10(8,9)6-4-2-1-3-5-6/h3-10H,11H2,1-2H3;3-13H2,1-2H3;1-5H,(H,7,8,9) |
| InChIKey | APNFTSMNRICGJE-UHFFFAOYSA-N |
| XLogP | 10.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.84 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane?
The IUPAC name of benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane (CID 91521840) is benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane.
What is the SMILES notation for benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane?
The canonical SMILES for benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane is CCCCCCCCCCCCC.Cc1ccc(Cc2ccc(C)cc2)cc1.O=S(=O)(O)c1ccccc1.
What is the InChIKey of benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane?
The InChIKey is APNFTSMNRICGJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C13H28.C6H6O3S/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-3-5-7-9-11-13-12-10-8-6-4-2;7-10(8,9)6-4-2-1-3-5-6/h3-10H,11H2,1-2H3;3-13H2,1-2H3;1-5H,(H,7,8,9).
What are the key properties of benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane?
benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane has a molecular weight of 538.84 g/mol, XLogP of 10.14, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonic acid;1-methyl-4-[(4-methylphenyl)methyl]benzene;tridecane is sourced from PubChem (CID 91521840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).