C26H28O3SSe — CID 11005584
(Z)-3-methyl-2-(4-methylphenyl)sulfonyl-1-phenyl-1-phenylselanylhex-1-en-3-ol (PubChem CID 11005584) has the molecular formula C26H28O3SSe and a molecular weight of 499.53 g/mol. Its IUPAC name is (Z)-3-methyl-2-(4-methylphenyl)sulfonyl-1-phenyl-1-phenylselanylhex-1-en-3-ol.
| Compound Name | (Z)-3-methyl-2-(4-methylphenyl)sulfonyl-1-phenyl-1-phenylselanylhex-1-en-3-ol |
|---|---|
| PubChem CID | 11005584 |
| Molecular Formula | C26H28O3SSe |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | (Z)-3-methyl-2-(4-methylphenyl)sulfonyl-1-phenyl-1-phenylselanylhex-1-en-3-ol |
| SMILES | CCCC(C)(O)/C(=C(/[Se]c1ccccc1)c1ccccc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H28O3SSe/c1-4-19-26(3,27)25(30(28,29)22-17-15-20(2)16-18-22)24(21-11-7-5-8-12-21)31-23-13-9-6-10-14-23/h5-18,27H,4,19H2,1-3H3/b25-24- |
| InChIKey | RJCNEJSTBCPLBV-IZHYLOQSSA-N |
| XLogP | 4.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|