C11H16O3S2 — CID 87065288
1-(4-methylphenyl)sulfonyl-1-sulfanylbutan-1-ol (PubChem CID 87065288) has the molecular formula C11H16O3S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-1-sulfanylbutan-1-ol.
| Compound Name | 1-(4-methylphenyl)sulfonyl-1-sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 87065288 |
| Molecular Formula | C11H16O3S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-1-sulfanylbutan-1-ol |
| SMILES | CCCC(O)(S)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H16O3S2/c1-3-8-11(12,15)16(13,14)10-6-4-9(2)5-7-10/h4-7,12,15H,3,8H2,1-2H3 |
| InChIKey | YFCIZVRFXRCUQY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|