C21H36O4S2 — CID 173216438
4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;4-methylbenzenesulfonic acid (PubChem CID 173216438) has the molecular formula C21H36O4S2 and a molecular weight of 416.65 g/mol. Its IUPAC name is 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;4-methylbenzenesulfonic acid.
| Compound Name | 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173216438 |
| Molecular Formula | C21H36O4S2 |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 4-butyl-2,2-dimethyl-4-sulfanyloctan-3-one;4-methylbenzenesulfonic acid |
| SMILES | CCCCC(S)(CCCC)C(=O)C(C)(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C14H28OS.C7H8O3S/c1-6-8-10-14(16,11-9-7-2)12(15)13(3,4)5;1-6-2-4-7(5-3-6)11(8,9)10/h16H,6-11H2,1-5H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | XAMXWNPKZBZMBP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|