C17H18O3S — CID 13445258
2-methyl-2-(4-methylphenyl)sulfonyl-1-phenylpropan-1-one (PubChem CID 13445258) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-methyl-2-(4-methylphenyl)sulfonyl-1-phenylpropan-1-one.
| Compound Name | 2-methyl-2-(4-methylphenyl)sulfonyl-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 13445258 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-methyl-2-(4-methylphenyl)sulfonyl-1-phenylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)C(C)(C)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H18O3S/c1-13-9-11-15(12-10-13)21(19,20)17(2,3)16(18)14-7-5-4-6-8-14/h4-12H,1-3H3 |
| InChIKey | WBXCFSRAWFNBHW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |