C27H22N2O3S — CID 139058029
(2S)-2-(4-methylphenyl)sulfonyl-1,2-diphenyl-2-phenyldiazenylethanone (PubChem CID 139058029) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is (2S)-2-(4-methylphenyl)sulfonyl-1,2-diphenyl-2-phenyldiazenylethanone.
| Compound Name | (2S)-2-(4-methylphenyl)sulfonyl-1,2-diphenyl-2-phenyldiazenylethanone |
|---|---|
| PubChem CID | 139058029 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (2S)-2-(4-methylphenyl)sulfonyl-1,2-diphenyl-2-phenyldiazenylethanone |
| SMILES | Cc1ccc(S(=O)(=O)[C@](/N=N/c2ccccc2)(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N2O3S/c1-21-17-19-25(20-18-21)33(31,32)27(23-13-7-3-8-14-23,26(30)22-11-5-2-6-12-22)29-28-24-15-9-4-10-16-24/h2-20H,1H3/b29-28+/t27-/m0/s1 |
| InChIKey | YIOPYVPHKRYHFD-PBWKAQAQSA-N |
| XLogP | 6.29 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|