C18H24Cl3NO2S — CID 154723300
[(E,3S)-4-[(S)-(4-methylphenyl)sulfinyl]non-4-en-3-yl] 2,2,2-trichloroethanimidate (PubChem CID 154723300) has the molecular formula C18H24Cl3NO2S and a molecular weight of 424.82 g/mol. Its IUPAC name is [(E,3S)-4-[(S)-(4-methylphenyl)sulfinyl]non-4-en-3-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E,3S)-4-[(S)-(4-methylphenyl)sulfinyl]non-4-en-3-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 154723300 |
| Molecular Formula | C18H24Cl3NO2S |
| Molecular Weight | 424.82 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | [(E,3S)-4-[(S)-(4-methylphenyl)sulfinyl]non-4-en-3-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](CC)/C(=C\CCCC)[S@@](=O)c1ccc(C)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H24Cl3NO2S/c1-4-6-7-8-16(15(5-2)24-17(22)18(19,20)21)25(23)14-11-9-13(3)10-12-14/h8-12,15,22H,4-7H2,1-3H3/b16-8+,22-17+/t15-,25-/m0/s1 |
| InChIKey | GEADCZSYPTVGQO-OZRFALJTSA-N |
| XLogP | 6.32 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.82 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|