C20H32O2S — CID 102376298
(Z,5S,8R)-8-methyl-7-(4-methylphenyl)sulfinyldodec-6-en-5-ol (PubChem CID 102376298) has the molecular formula C20H32O2S and a molecular weight of 336.54 g/mol. Its IUPAC name is (Z,5S,8R)-8-methyl-7-(4-methylphenyl)sulfinyldodec-6-en-5-ol.
| Compound Name | (Z,5S,8R)-8-methyl-7-(4-methylphenyl)sulfinyldodec-6-en-5-ol |
|---|---|
| PubChem CID | 102376298 |
| Molecular Formula | C20H32O2S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (Z,5S,8R)-8-methyl-7-(4-methylphenyl)sulfinyldodec-6-en-5-ol |
| SMILES | CCCC[C@H](O)/C=C(/[C@H](C)CCCC)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H32O2S/c1-5-7-9-17(4)20(15-18(21)10-8-6-2)23(22)19-13-11-16(3)12-14-19/h11-15,17-18,21H,5-10H2,1-4H3/b20-15-/t17-,18+,23?/m1/s1 |
| InChIKey | CQYXEEQREOHEHH-HUGBXFFCSA-N |
| XLogP | 5.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |