C18H26BrNO4S2Si — CID 11677606
[(1R,2S)-1-(4-bromo-1,3-thiazol-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl] methanesulfonate (PubChem CID 11677606) has the molecular formula C18H26BrNO4S2Si and a molecular weight of 492.53 g/mol. Its IUPAC name is [(1R,2S)-1-(4-bromo-1,3-thiazol-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl] methanesulfonate.
| Compound Name | [(1R,2S)-1-(4-bromo-1,3-thiazol-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl] methanesulfonate |
|---|---|
| PubChem CID | 11677606 |
| Molecular Formula | C18H26BrNO4S2Si |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | [(1R,2S)-1-(4-bromo-1,3-thiazol-2-yl)-2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@@H](OS(C)(=O)=O)c1nc(Br)cs1 |
| InChI | InChI=1S/C18H26BrNO4S2Si/c1-18(2,3)27(5,6)24-15(13-10-8-7-9-11-13)16(23-26(4,21)22)17-20-14(19)12-25-17/h7-12,15-16H,1-6H3/t15-,16+/m0/s1 |
| InChIKey | DMBORRKRVZEJLO-JKSUJKDBSA-N |
| XLogP | 5.69 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|