C17H25NO3S2Si — CID 10362565
3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]thiophene-2-sulfonamide (PubChem CID 10362565) has the molecular formula C17H25NO3S2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]thiophene-2-sulfonamide.
| Compound Name | 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10362565 |
| Molecular Formula | C17H25NO3S2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 3-[[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]thiophene-2-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)OC(c1ccccc1)c1ccsc1S(N)(=O)=O |
| InChI | InChI=1S/C17H25NO3S2Si/c1-17(2,3)24(4,5)21-15(13-9-7-6-8-10-13)14-11-12-22-16(14)23(18,19)20/h6-12,15H,1-5H3,(H2,18,19,20) |
| InChIKey | APJHGLLMCCASDY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|