C22H25NO3S2 — CID 140561234
3-[(2S,3S)-1-hydroxy-3-methyl-1,1-diphenylpentan-2-yl]thiophene-2-sulfonamide (PubChem CID 140561234) has the molecular formula C22H25NO3S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 3-[(2S,3S)-1-hydroxy-3-methyl-1,1-diphenylpentan-2-yl]thiophene-2-sulfonamide.
| Compound Name | 3-[(2S,3S)-1-hydroxy-3-methyl-1,1-diphenylpentan-2-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 140561234 |
| Molecular Formula | C22H25NO3S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 3-[(2S,3S)-1-hydroxy-3-methyl-1,1-diphenylpentan-2-yl]thiophene-2-sulfonamide |
| SMILES | CC[C@H](C)[C@@H](c1ccsc1S(N)(=O)=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3S2/c1-3-16(2)20(19-14-15-27-21(19)28(23,25)26)22(24,17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-16,20,24H,3H2,1-2H3,(H2,23,25,26)/t16-,20-/m0/s1 |
| InChIKey | HNXLDDUUVNNVRU-JXFKEZNVSA-N |
| XLogP | 4.46 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |