C12H21NO3S2 — CID 140561210
3-[(4S,5S)-3-hydroxy-5-methylheptan-4-yl]thiophene-2-sulfonamide (PubChem CID 140561210) has the molecular formula C12H21NO3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-[(4S,5S)-3-hydroxy-5-methylheptan-4-yl]thiophene-2-sulfonamide.
| Compound Name | 3-[(4S,5S)-3-hydroxy-5-methylheptan-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 140561210 |
| Molecular Formula | C12H21NO3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-[(4S,5S)-3-hydroxy-5-methylheptan-4-yl]thiophene-2-sulfonamide |
| SMILES | CCC(O)C(c1ccsc1S(N)(=O)=O)[C@@H](C)CC |
| InChI | InChI=1S/C12H21NO3S2/c1-4-8(3)11(10(14)5-2)9-6-7-17-12(9)18(13,15)16/h6-8,10-11,14H,4-5H2,1-3H3,(H2,13,15,16)/t8-,10?,11?/m0/s1 |
| InChIKey | XHGPEASQRWUZKS-PUSIOWJLSA-N |
| XLogP | 2.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |