C16H25NO3S — CID 140550981
2-[(3S,4S)-5-hydroxy-3,7-dimethyloct-6-en-4-yl]benzenesulfonamide (PubChem CID 140550981) has the molecular formula C16H25NO3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-[(3S,4S)-5-hydroxy-3,7-dimethyloct-6-en-4-yl]benzenesulfonamide.
| Compound Name | 2-[(3S,4S)-5-hydroxy-3,7-dimethyloct-6-en-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140550981 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 2-[(3S,4S)-5-hydroxy-3,7-dimethyloct-6-en-4-yl]benzenesulfonamide |
| SMILES | CC[C@H](C)[C@@H](c1ccccc1S(N)(=O)=O)C(O)C=C(C)C |
| InChI | InChI=1S/C16H25NO3S/c1-5-12(4)16(14(18)10-11(2)3)13-8-6-7-9-15(13)21(17,19)20/h6-10,12,14,16,18H,5H2,1-4H3,(H2,17,19,20)/t12-,14?,16-/m0/s1 |
| InChIKey | PGYKQDKDNZVWCV-PDULFRILSA-N |
| XLogP | 2.79 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|