C15H25NO3S — CID 140551026
2-[(2S,3S)-1-hydroxy-3-methyloctan-2-yl]benzenesulfonamide (PubChem CID 140551026) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-[(2S,3S)-1-hydroxy-3-methyloctan-2-yl]benzenesulfonamide.
| Compound Name | 2-[(2S,3S)-1-hydroxy-3-methyloctan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140551026 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-[(2S,3S)-1-hydroxy-3-methyloctan-2-yl]benzenesulfonamide |
| SMILES | CCCCC[C@H](C)[C@H](CO)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C15H25NO3S/c1-3-4-5-8-12(2)14(11-17)13-9-6-7-10-15(13)20(16,18)19/h6-7,9-10,12,14,17H,3-5,8,11H2,1-2H3,(H2,16,18,19)/t12-,14-/m0/s1 |
| InChIKey | DLVBVWPWNPOXGF-JSGCOSHPSA-N |
| XLogP | 2.63 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|