C18H31NO3S — CID 140550987
2-[(3S,4S)-5-hydroxy-3-methylundecan-4-yl]benzenesulfonamide (PubChem CID 140550987) has the molecular formula C18H31NO3S and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-[(3S,4S)-5-hydroxy-3-methylundecan-4-yl]benzenesulfonamide.
| Compound Name | 2-[(3S,4S)-5-hydroxy-3-methylundecan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 140550987 |
| Molecular Formula | C18H31NO3S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-[(3S,4S)-5-hydroxy-3-methylundecan-4-yl]benzenesulfonamide |
| SMILES | CCCCCCC(O)[C@H](c1ccccc1S(N)(=O)=O)[C@@H](C)CC |
| InChI | InChI=1S/C18H31NO3S/c1-4-6-7-8-12-16(20)18(14(3)5-2)15-11-9-10-13-17(15)23(19,21)22/h9-11,13-14,16,18,20H,4-8,12H2,1-3H3,(H2,19,21,22)/t14-,16?,18-/m0/s1 |
| InChIKey | OLAWBLUUDSXZKH-NIQRUEKDSA-N |
| XLogP | 3.80 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|