C20H33NO4S2Si2 — CID 10790598
5-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-trimethylsilyloxymethyl]thiophene-3-sulfonamide (PubChem CID 10790598) has the molecular formula C20H33NO4S2Si2 and a molecular weight of 471.79 g/mol. Its IUPAC name is 5-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-trimethylsilyloxymethyl]thiophene-3-sulfonamide.
| Compound Name | 5-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-trimethylsilyloxymethyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 10790598 |
| Molecular Formula | C20H33NO4S2Si2 |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 5-[[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-trimethylsilyloxymethyl]thiophene-3-sulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(O[Si](C)(C)C)c2cc(S(N)(=O)=O)cs2)cc1 |
| InChI | InChI=1S/C20H33NO4S2Si2/c1-20(2,3)29(7,8)24-16-11-9-15(10-12-16)19(25-28(4,5)6)18-13-17(14-26-18)27(21,22)23/h9-14,19H,1-8H3,(H2,21,22,23) |
| InChIKey | VLFDHSIGXNDEPA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|